2. What’s solutions? Electrolytes SolubilityReactionsRandy $100 $200 $300 $400 $500

3. Sports Questions

4. $100 When solutions dissolve on their own, this process is ______ as it is thermodynamically ________

5. What is Spontaneous /favored?

6. $200 When two chemicals are mixed with a buret to find the concentration of the unknown

7. What is a titration?

8. $300 acid-base reactions are referred to as _____ reactions $300

9. What is neutralization?

10. $400 This group on the periodic table is always soluble in solution

11. What are group 1 metals?

12. $500 The concentration of nitrate in a 2 liter solution of 50g Pb(NO 3 ) 2 aq.

13. What is.151M (PROOF) I V 50g/(207.2+(28+96))g/mol=.151mols Pb(NO3)2.151mols Pb(NO3)2 * 2mols NO3/mol Pb(NO3)2=.302mols.302mols NO3/2 liters=.151M

14. Math Questions

15. $100 a compound that is able to dissociate into ions

16. What is an electrolyte?

17. $200 A compound that is unable to dissociate into ions

18. What is a non-electrolyte?

19. $300 strong acids are considered ____ electrolytes

20. What is strong?

21. $400 The Strong Acids, strong bases and this are considered the strongest electrolytes

22. What are ionic solids?

23. $500 This is an example of a strong electrolyte with the sulfate ion and a low pH

24. What is Sulfuric acid(H2SO4)?

25. Misc Questions

26. $100 When two solutions react to form a solid, this reaction occurs

27. What is precipitation?

28. $200 When the oxidation numbers of two reactants change, this reaction occurs

29. What is a redox reaction?

30. $300 In a combustion reaction, oxygen gas reacts with a ______ to form CO2 and water

31. What is carbohydrate ?

32. $400 When two chemicals combine into one chemical, this reaction occurs

33. What is a synthesis reaction?

34. $500 When sodium carbonate is reacted in solution with calcium nitrate, this is precipitated

35. What is Calcium carbonate?

36. Geography Questions

37. $100 Nitrate anions are soluble when

38. What is always?

39. $200 Like dissolves _____

40. What is Like?

41. $300 silver chloride is…

42. What is insoluble?

43. $400 Copper(II) solutions usually take on this bright color

44. What is Blue?

45. $500 A Ksp of 1.63 indicates this

46. What is very soluble?

47. Science Questions

48. This is the name for what is being dissolved

49. What is the solute?

50. This is the name of what does the dissolving.

51. What is the solvent?

52. unlike a mixture, a solution is

53. What is homogenous ?

54. When a chemical is in solution it is referred to as this state

55. What is Aqueous?

56. a compound is dissolved by the _______ of its pieces

57. What is Dissociation?