Presentation is loading. Please wait.

Presentation is loading. Please wait.

SEMESTER I EXAM Review A 2010 SHELDON BIOLOGY. Match Parts of Scientific Method Problem Statement Hypothesis Experiment Conclusion If and then… Agree.

Similar presentations


Presentation on theme: "SEMESTER I EXAM Review A 2010 SHELDON BIOLOGY. Match Parts of Scientific Method Problem Statement Hypothesis Experiment Conclusion If and then… Agree."— Presentation transcript:

1 SEMESTER I EXAM Review A 2010 SHELDON BIOLOGY

2 Match Parts of Scientific Method Problem Statement Hypothesis Experiment Conclusion If and then… Agree or disagree with hypothesis Data tables, graphs What is the effect of…?

3 Match Parts of Scientific Method Problem Statement Hypothesis Experiment Conclusion If and then… Agree or disagree with hypothesis Data tables, graphs What is the effect of…?

4 Identify the variables? Which is the independent variable? Which is the dependent variable?

5 Identify the variables? Which is the independent variable? (x-AXIS) temperature Which is the dependent variable? (y-AXIS) Log. Generations per hour

6 Which is a HYPOTHESIS and which is a THEORY. If you put cold water in a fish tank, then fish will slow down. All cells come from pre-existing cells. Hypothesis Theory

7 #7 Which is “spontaneous generation” and which is from the “cell theory?” The basic unit of life is a cell All cells come from pre-existing cells. Life comes from rotten meat (non-life). Cell theory Spontaneous generation

8 Which part of the experiment… Does not contain the tested variable? A. control B. constant C. independent variable D. dependent variable? ANSWER: control ( reference area) CONSTANTS-all things that stay the same

9 #11 Put in the correct order: Community Population Organelle Organ System Organism Organ tissue Ecosystem Molecule Cell Biosphere Ecosystem Community Population organism Organ system Organ Tissue Cell Organelle Molecule

10 Where would you dipose of waste chemicals in the lab? Sink Chemical waste jar Trash can ANSWER: chemical waste jar

11 Which goes with ASEXUAL and which goes with SEXUAL reproduction? One parent Two parents Exactly like parents May be different ASEXUAL SEXUAL ASEXUAL SEXUAL

12 HOW MANY VARIABLES DO YOU TEST AT A TIME IN AN EXPERIMENT? One Two Three As many as you want ANSWER: ONE

13 #10 Which is HOMEOSTASIS and which is METABOLISM? Sum of all the chemical reactions in an organism An organism maintains a stable internal environment even when the external environment is not METABOLISM HOMEOSTASIS

14 Which are constants, which are controls? Same beaker in each trial Set-up of room temperature as compared to hot and cold Same crickets for each trial Constant Control constant

15 Which are ATOMS and which are CELLS? Amoeba Carbon Hydrogen blood CELL ATOM CELL

16 Which is an INFERENCE and which is an OBSERVATION? The penguin is black and white The penguin acts like a duck The penguin is cute The penguin is eating fish. Observation Inference Observation

17 What is the correct way to… Detect an odor in the lab? Dispose of broken glass? Dispose of test tube liquids after the lab? Wafting In the crock In the waste container on the lab table.

18 The energy used by most organisms for metabolism and growth ULTIMATELY comes from: A. heat B. decomposition of plants C. carbon dioxide D. sun ANSWER: D. sun

19 What would each tool be used for? Hold test tube Protect eyes Hold beaker

20 How many p, n, and e-? 19 mass number (p + n) F 9 atomic number (p) (also e-) ANSWER: 9 p, 9 e-, 10 n #p+ and #e- = at. no. #n = mass no. – at. no.

21 #6 Atoms with different number of neutrons from its neutral atom are: An ion An isotope A bond A molecule ANSWER: an isotope

22 Atoms with different number of electrons from its neutral atom are: An ion An isotope A bond A molecule ANSWER: an ion Charged atom Na+ Cl-

23 Water has unequal sharing of electrons. It is… A. nonpolar ionic B. nonpolar covalent C. polar ionic D. polar covalent ANSWER: D Polar covalent – unequal sharing of e-

24 In a salt water solution, identify the solute and the solvent: Solute = salt (is being dissolved) Solvent = water (does the dissolving)

25 Which shows the correct bonding ability of carbon?

26 REASON: 4 e- in its outer shell (can bond to 4 more e- to fill its outer shell of 8)

27 Ice floats because… A. it is colder than liquid water B. its water molecules are farther apart due to H-bonding C. it is denser than liquid water D. its molecules are moving faster ANSWER: B

28 #5 Fill in the blanks: In an ionic bond the electrons are _______________ and in a covalent bond the electrons are_______. ANSWER: transferred (lost/gained) shared

29 Describe water’s property Surface tension Heat of fusion Capillarity High (float a bug) High (slow to freeze) Rises in narrow tubes

30 What is the element? Na C O H Sodium Carbon Oxygen hydrogen

31 An atom is stable when… A. number of electrons = number of protons B. outer electron shells are full C. number of neutrons = number of protons ANSWER: B #9 Atoms will form compounds to fill outer electron shells

32 What is the charge of each? Electron Proton neutron Negative Positive neutral

33 #8 What makes up an atom’s nucleus? Protons and neutrons

34 #15 Fill in the blanks In an acid the ___________ions are donated to the water solution, but in a base the __________ions are donated to the water solution: ANSWER: H+ (acid) OH- (base) hydronium hydroxide

35 Match: pH 7 A. weak base pH 13 B. strong base pH 2 C. neutral pH 6 D. weak acid E. strong acid C. neutral Strong base Strong acid Weak acid

36 #18 MATCH THE TYPE OF CARBO: monosaccharide, disaccharide, polysaccharide Glucose Glycogen Sucrose Starch lactose Monosaccharide Polysaccharide Disaccharide Polysaccharide Disaccharide

37 #2 Which is correct? A substance that cannot be broken down into other substances by ordinary chemical means is: A. molecule B. buffer C. element D. cell E. compound ANSWER: element

38 #19 Which is an saturated, a monounsaturated, or a polyunsaturated fat? A. CH3CH2CH2CH2CH2CH=CHCH2CH =CHOOH B. CH3CH2CH2COOH C. A. polyunsat (more than 1 =) B. satur. (no =) C. monounsat (one =)

39 What fat is this the structure for?

40 Steroid (4 fused rings)

41 Which is an element and which is a compound? C CO Cu CH 4 ANSWER: element C and Cu compound CO and CH 4

42 Which is a symbol and which is a formula? C CO Cu CH 4 ANSWER: symbol C and Cu formula CO and CH 4

43 Why do atoms join other atoms to form compounds? A. to make even number of electrons B. to fill their outer electron shells C. to become neutral ANSWER: B Fill 2,8,8

44 Which is NOT a lipid? A. wax B. phospholipid C. cholesterol D. RNA E. steroid ANSWER: D

45 Which are ions? Cl Cl - H 2 OH - H + ANSWER: Ions are Cl -,OH -, H +

46 Identify the bond: A. - B. Ξ C. = A. single B. triple C. double

47 Which subatomic particle… Lacks a charge Is in the nucleus? A. proton B. electron C. neutron ANSWER: neutron Protons (+) Electrons (-)

48 Which water property is it? A. climb narrow tubes B. form a film on water surface C. slow to heat D. slow to freeze 1. heat of fusion 2. heat of vaporization 3. capillarity 4. surface tension

49 water property answers A. climb narrow tubes B. form a film on water surface C. slow to heat D. slow to freeze 3. capillarity 4. surface tension 1. high heat of vaporization 2. high heat of fusion

50 Why does ice expand when freezing? 1. It gets gains mass. 2. It gains electrons. 3. It loses electrons. 4. The H-bonds form an open lattice. ANSWER: 4

51 Which is cohesion and which is adhesion? A. sticking to like substances B. sticking to unlike substances ANSWER: “A” is cohesion “B” is adhesion

52 In a salt water solution… Which is the solute, which is the solvent?

53 Which is a mixture and which is a compound? Salt water Glucose Water Air Blood Mixture Compound C 6 H 12 O 6 H 2 O compound Mixture mixture

54 Identify the monomer: Carbohydrate Protein Lipid Nucleic Acid Monosaccharide Amino Acid Fatty acid + glycerol nucleotide

55 What two ions does water dissociate into? H and O H and OH H + and OH - H 2 and O 2 ANSWER: H + and OH - (acids) (bases)

56 An atom is stable when: A. It’s protons equal its neutrons B. It’s electrons equal its protons C. It’s outer electron shell is filled. D. It’s outer electron shell is empty. ANSWER: C (e- fill 2,8,8)

57 What part of atoms form bonds? Electrons Protons Neutrons ANSWER: electrons

58 If you had an atomic number of… 12, how many electrons would be in the outer shell? 2 8 4 6 ANSWER: 2 (fills 2, 8, 2)

59 Polar Covalent means: A. electrons are shared equally B. electrons are not shared equally ANSWER: electrons are not shared equally Like water (H+ end and O- end)

60 A carbon atom can form: A. Two covalent bonds B. Three covalent bonds C. Four covalent bonds D. Five covalent bonds ANSWER: C

61 What are other names for proteins? Polypeptide Amino acid chain Fatty acid Polyunsaturate Polysaccharide ANSWER: polypeptide, amino acid chain

62 What are the four bases of nucleic acids? 1. A-C-O-T 2. A-T-C-G 3. C-G-O-H 4. T-O-G-C ANSWER: A-T-C-G

63 What are the reactants and what are the products?

64 What are the reactant and what are the products?

65 Identify the substrate, the active site, and the product. A B C

66 Enzymes end in: A. -ase B. -ose C. -ise D. –ese ANSWER: -ase

67 All organic compounds contain: A. C and O and N B. C and Ca and S C. O and P D. C and H and O ANSWER: D

68 Identify the substrate, the active site, and the product. Substrate = what the enzyme acts upon Active site=where the enzyme + substrate meet

69 How strong are H-bonds? A. weak B. medium C. strong ANSWER: weak

70 Which are enzymes? A. proteins B. fats C. nucleic acids D. carbohydrates ANSWER: A. proteins

71 Which are enzymes? A. phospholipid membranes B. Energy sources C. biological catalysts (speed up reactions) D. storage molecules ANSWER: biological catalysts

72 How did the enzyme lactase work in the Lactaid® lab? Lactose is the disaccharide that breaks down into glucose and galactose by the aid of lactase (the enzyme).

73 Which is a saturated fat? A. B. C. CH 3 CH 2 CH 2 COOH CH3(CH2)4CH=CHCH2CH=CH(CH2)7COO H

74 Which is a saturated fat? A. B. C. CH 3 CH 2 CH 2 COOH CH3(CH2)4CH=CHCH2CH=CH(CH2)7COO H

75 What’s it called? Removing water to link monomers for form a polymer: A. dehydration synthesis B. hydrolysis C. chemiosmosis ANSWER: A Hydrolysis adds water to split polymers

76 Matching: 1. glycogen 2. cellulose 3. glucose 4. starch A. a polysaccharide in plant cells cell walls B. The storage form of glucose in plants C. The storage form of glucose in animals D. simple sugar

77 Matching: 1. glycogen C 2. cellulose A 3. glucose D 4. starch B A. a polysaccharide in plant cell walls B. The storage form of glucose in plants C. The storage form of glucose in animals D. simple sugar

78 Matching: Monomers 1. fatty acids + glycerol 2. monosaccharide 3. nucleotide 4. amino acid Polymers A. protein B. lipids C. nucleic acids D. carbohydrates

79 Matching: Monomers 1. fatty acids + glycerol B 2. monosaccharide D 3. nucleotide C 4. amino acid A Polymers A. protein B. lipids C. nucleic acids D. carbohydrates

80 Which one does not belong with the other three terms? A. protein B. polypeptide C. lipid D. amino acid chain ANSWER: C

81 Which test is this? Food sample turned blue-black in the presence of iodine? A. for protein B. for starch C. for lipids D. for simple sugars ANSWER: B

82 MACROMOLECULE TESTS A. for protein (Biuret’s blue to purple) B. for starch (iodine turns blue-black) C. for lipids (paper translucent to light) D. for simple sugars (Benedict’s blue to orange)

83 What is the most abundant organic compound on earth? (It is also in cell walls of plants.) A. glucose B. chitin C. peptidoglycan D. cellulose ANSWER: D

84 What is another name for a “fat?” A. triglyceride B. protein C. nucleic acid D. polysaccharide ANSWER: A

85 Which microscope(s) can view organisms up to 1,000,000 times? A. CLM B. SEM C. TEM ANSWER: both SEM and TEM

86 What is the ability to tell two objects apart in a microscope? A. resolving power B. magnification C.parfocal D. scanning ANSWER: A

87 Convert 500 µm to nm A. 0.5 nm B. 5,000 nm C. 500,000 nm D. 5,000,000 nm ANSWER: C

88 Metric to Metric Conversion Km hm dkm m dm cm mm µm nm Å 3 3

89 What do eukaryotic cells have that prokaryotic cells do not? A. plasma membrane B. nucleus C. cell wall D. flagellum ANSWER: B

90 What do bacteria have that protists do not? A. cell wall B. nucleus C. capsule D. chloroplasts ANSWER: C

91 What structures can be found in plant cells but not in animal cells? A. centrioles and cilia B. chloroplasts and flagella C. capsule and cell wall D. cell wall and chloroplasts ANSWER: D

92 What structures can be found in animal cells but not in plant cells? A. centrioles and cilia B. chloroplasts and flagella C. capsule and cell wall D. cell wall and chloroplasts ANSWER: A

93

94 Put in order from smallest to largest: Mitochondrion ribosome nucleus vesicle ANSWER: (smallest) ribosome Vesicle Mitochondrion Nucleus (largest)

95 Microtubules and microfilaments are both part of a cell’s… A. nucleus B. cytoskeleton C. endomembrane D. endoplasmic reticulum ANSWER: B

96 What is the job of centrioles? A. protect the cell B. cell movement C. cell division D. DNA C. cell division

97 Which organelle repackages proteins? A. mitochondrion B. chloroplast C. Golgi apparatus D. lysosome ANSWER: C

98 Where are ribosomes assembled? A. nucleolus B. Golgi apparatus C. mitochondrion D. lysosomes ANSWER: A

99 What are loose, long fibers of DNA? A. ER B. chromosomes C. nucleolus D. chromatin ANSWER: D

100 Rough and Smooth ER What’s the difference? (structure and function) ANSWER: Rough (has ribosomes, assembles proteins) and Smooth (has no ribosomes and assembles lipids)

101

102 What is the general term for… Microtubules and microfilaments? A. cytoskeleton B. plasma membrane C. flagella and cilia D. lysosomes ANSWER: A

103

104

105 Name the Organelles

106

107 Which is the plant cell?

108

109 Which organelle? 1. Stores food or water 2. Modifies proteins 3. Called the “clean- up” crew 4. Is the site of the genetic material 5. Is the “powerhouse” 1. VACUOLE 2. GOLGI APPARATUS 3. LYSOSOME 4. NUCLEUS 5. MITOCHONDRION

110 Which organelle? 1. Is the site of photosynthesis? 2. Is the support framework? 3. Controls what goes in and out of the cell? 4. Carries materials from the ER to the Golgi. 1. chloroplast 2. cytoskeleton 3. plasma membrane 4. Vesicle

111 How big is one cell’s length? A. 1 mm B. 0.5 mm C. 2 mm D. 0.05 mm ANSWER: 0.5 mm

112 In which cells would you find these organelles? A. mitochondrion B. ribosomes Plant and animal All cells (plant, animal and prokaryote)

113 In what type of cells would you find cell walls? A. plant B. animal C. bacteria ANSWER: A and C

114 Which organelle is the chloroplast and which is the mitochondrion? (answer next slide)

115 Which organelle is the chloroplast and which is the mitochondrion?

116 Who first coined the word “cells?” Pasteur Leeuwenhoek Hooke Virchow ANSWER: Hooke

117 Who is given credit for the first microscope? Pasteur Leeuwenhoek Hooke Virchow ANSWER: Leeuwenhoek

118 Why would the cell membrane also be called the Fluid Mosaic Model?

119 Fluid Mosaic Model Parts of the membrane shift back and forth There are parts (protein channels and carbohydrate chains) embedded in it.

120 Locate: hydrophobic layer hydrophilic layer carbohydrate chain protein channel

121 ANSWERS: Hydrophilic hydrophobic Carbohydrate chain Protein channel

122 In which direction will the water flow?

123 From hypotonic to hypertonic solution

124 In equilibrium it means there is… A. No net movement of molecules across a membrane. B. No movement of molecules across a membrane. C. more movement of molecules across a membrane. ANSWER: A

125 O=osmosis D=diffusion N=neither B=both Hi to lo concentration Through a selectively permeable membrane Flow of water Flow of gases Down the gradient Against the gradient Both O O D B N

126 Identify Isotonic, hypotonic, hypertonic

127 Identify Isotonic, hypotonic, hypertonic solutions outside the cell. HYPOTONICISOTONICHYPERTONIC

128 What type of passive transport through a cell is using a protein? A. active B. phagocytosis C. diffusion D. facilitated diffusion ANSWER: D

129 Matching: CHOICES 1. engulfing small pockets of liquid 2. material leaving the cell 3. engulfing large particles 4. general term form engulfing particles into the cell Endocytosis Pinocytosis Exocytosis Phagocytosis

130 Matching: 1. engulfing small pockets of liquid 2. material leaving the cell 3. engulfing large particles 4. general term form engulfing particles into the cell Pinocytosis Exocytosis Phagocytosis Endocytosis

131 How is active transport different from passive transport? A. uses a protein B. uses energy C. uses a membrane D. is down the gradient E. Moves against the gradient ANSWER: B and E

132 Identify as U=unicellular or M=multicellular Amoeba Human Bacteria Paramecium Worm tree U M U U M M


Download ppt "SEMESTER I EXAM Review A 2010 SHELDON BIOLOGY. Match Parts of Scientific Method Problem Statement Hypothesis Experiment Conclusion If and then… Agree."

Similar presentations


Ads by Google