Presentation is loading. Please wait.

Presentation is loading. Please wait.

SEMESTER I EXAM Review A 2011 SHELDON BIOLOGY. Match Parts of Scientific Method Problem Statement Hypothesis Experiment Conclusion If and then… Agree.

Similar presentations

Presentation on theme: "SEMESTER I EXAM Review A 2011 SHELDON BIOLOGY. Match Parts of Scientific Method Problem Statement Hypothesis Experiment Conclusion If and then… Agree."— Presentation transcript:


2 Match Parts of Scientific Method Problem Statement Hypothesis Experiment Conclusion If and then… Agree or disagree with hypothesis Data tables, graphs What is the effect of…?

3 Match Parts of Scientific Method Problem Statement Hypothesis Experiment Conclusion If and then… Agree or disagree with hypothesis Data tables, graphs What is the effect of…?

4 Identify the variables? Which is the independent variable? Which is the dependent variable?

5 Identify the variables? Which is the independent variable? (x-AXIS) temperature Which is the dependent variable? (y-AXIS) Log. Generations per hour

6 Which is a HYPOTHESIS and which is a THEORY. If you put cold water in a fish tank, then the fish will slow down. All cells come from pre-existing cells. Hypothesis Theory

7 Which is spontaneous generation and which is from the cell theory? The basic unit of life is a cell All cells come from pre-existing cells. Life comes from rotten meat (non-life). Cell theory Spontaneous generation

8 Which part of the experiment… Does not contain the tested variable (but is used as a comparison)? A. control B. constant C. independent variable D. dependent variable? ANSWER: control

9 Put in the correct order: Community Population Organelle Organ System Organism Organ tissue Ecosystem Molecule cell Ecosystem Community Population organism Organ system Organ Tissue Cell Organelle Molecule

10 Where would you dipose of waste chemicals in the lab? Sink Chemical waste jar Trash can ANSWER: chemical waste jar

11 Which goes with ASEXUAL and which goes with SEXUAL reproduction? One parent Two parents Exactly like parent May be different ASEXUAL SEXUAL ASEXUAL SEXUAL


13 Which is HOMEOSTASIS and which is METABOLISM? Sum of all the chemical reactions in an organism An organism maintains a stable internal environment even when the external environment is not METABOLISM HOMEOSTASIS

14 Which is the correctly written scientific name for the Great Horned Owl? A. Bubo virginianus (italic.) B. Bubo virginianus (no italic.) C. Bubo Virginianus (both capital.) D. Bubo Virginianus (underlined + italic.) E. Bubo virginianus (only underlined) ANSWER: A and E Note: genus and species

15 Which are constants, which are controls? Same beaker in each trial Set-up of room temperature as compared to hot and cold Same crickets for each trial Constant Control constant

16 Which are ATOMS (smallest unit of elements) and which are CELLS (smallest living unit)? Amoeba Carbon Hydrogen blood CELL ATOM CELL

17 Which is an INFERENCE and which is an OBSERVATION? The penguin is black and white The penguin acts like a duck The penguin is cute The penguin is eating fish. Observation (senses or measuring) Inference (own opinion, experiences) Inference Observation

18 What is the correct way to… Detect an odor in the lab? Care for acid in eyes Dispose of broken test tube after the lab? Wafting Rinse in eye wash station In the designated broken glass container – Boo Yah

19 The energy used by most organisms for metabolism and growth ULTIMATELY comes from: A. heat B. decomposition of plants C. carbon dioxide D. sun ANSWER: D. sun

20 What would each tool be used for? Hold test tube Protect eyes Hold beaker

21 How many p, n, and e-? 19 mass number (p + n) F 9 atomic number (p) (also e-) ANSWER: 9 p, 9 e-, 10 n p+ and e- = at. no. #n = mass no. – at. no.

22 Prokaryotic – no nucleus bacteria Eukaryotic – has a nucleus protists, fungi, plants, animals

23 Atoms with different number of neutrons from its neutral atom (as seen on Periodic Table) is: An ion An isotope A bond A molecule ANSWER: an isotope

24 Water has unequal sharing of electrons. It is… A. nonpolar ionic B. nonpolar covalent C. polar ionic D. polar covalent ANSWER: D

25 Interpret the graph Independent variable Dependent variable Which sugar induces more bacterial growth?

26 Interpret the graph Independent variable – Time (hours) Dependent variable –log number of viable bacterial/mL Which sugar induces more bacterial growth? Glucose only

27 In a salt water solution, identify the solute, the solvent, and the solution: Solute = salt (is being dissolved) Solvent = water (does the dissolving) Solution = solvent + solute

28 Which shows the correct bonding ability of carbon?

29 Carbon has 4 electrons in its outermost shell…so it can bond to four more to have a filled shell.

30 Atoms with different number of electrons from its neutral atom is: An ion An isotope A bond A molecule ANSWER: an ion (charged atom, lost or gained electrons)

31 Ice floats because… A. it is colder than liquid water B. its water molecules are farther apart due to H- bonding (under 4 o C) C. it is denser than liquid water D. its molecules are moving faster ANSWER: B H-bonding = H+ end attracts O- end

32 Fill in the blanks: In an ionic bond the electrons are _______________ and in a covalent bond the electrons are_______. ANSWER: transferred (lost/gained) shared

33 Describe waters property Surface tension Heat of fusion Capillarity High Rises in narrow tubes

34 What is the element? Na C O H Sodium Carbon Oxygen hydrogen

35 An atom is stable when… A. number of electrons = number of protons B. outer electron shells are full C. number of neutrons = number of protons ANSWER: B

36 What is the charge of each? Electron Proton neutron Negative Positive neutral

37 Which tool is the most precise for measuring water?

38 Which tool is the most precise for measuring water?(graduated cylinder)

39 Fill in the blanks In an acid the ___________ions are donated to the water solution, but in a base the __________ions are donated to the water solution: ANSWER: H+ OH- hydronium hydroxide

40 MATCH THE TYPE OF CARBO: monosaccharide, disaccharide, polysaccharide Glucose C 6 H 12 O 6 Glycogen (lots of glucoses-animals) Sucrose C 12 H 22 O 11 Starch (lots of glucoses- plants) Monosaccharide Polysaccharide Disaccharide Polysaccharide

41 Match the pH pH 1 pH 6 pH 14 pH 7 pH 8 Weak acid Neutral Weak base Strong base Strong acid

42 Match the pH pH 1 pH 6 pH 14 pH 7 pH 8 Weak acid Neutral Weak base Strong base Strong acid

43 Which is correct? A substance that cannot be broken down into other substances by ordinary chemical means is: A. molecule B. buffer C. element D. cell E. compound ANSWER: element

44 Which is an saturated, a monounsaturated, or a polyunsaturated fat? A. CH3CH2CH2CH2CH2CH=CHCH2CH =CHOOH B. CH3CH2CH2COOH C. A. polyunsat (more than 1 =) B. satur. (no =) C. monounsat (one =)

45 What fat is this the structure for?

46 Steroid (4 fused rings)

47 Which is an element and which is a compound? C CO Cu CH 4 ANSWER: element C and Cu compound CO and CH 4

48 Which is a symbol and which is a formula? C CO Cu CH 4 ANSWER: symbol (abrev. for element) C and Cu formula (abrev. For compound) CO and CH 4

49 Which should you not do to heated test tubes? (may be more than one) 1. Heat 2. Heat with a cork 3. Throw away if chipped 4. Point toward you 5. Hold with a test tube clamp if hot ANSWER: 2 and 4

50 Why do atoms join other atoms to form compounds? A. to make even number of electrons B. to fill their outer electron shells C. to become neutral ANSWER: B Fill 2,8,8

51 Which is NOT a lipid? A. wax B. phospholipid C. cholesterol D. RNA E. steroid ANSWER: D

52 Which are ions? Cl Cl - H 2 OH - H + ANSWER: Ions are Cl -,OH -, H + Lost or gained electrons

53 Identify the bond: A. - B. Ξ C. = A. single B. triple C. double

54 Which subatomic particle… Lacks a charge Is in the nucleus? A. proton B. electron C. neutron ANSWER: neutron Protons (+) Electrons (-)

55 Which water property is it? A. climb narrow tubes B. form a film on water surface C. slow to heat D. slow to freeze 1. heat of fusion 2. heat of vaporization 3. capillarity 4. surface tension

56 Which water property is it? A. climb narrow tubes B. form a film on water surface C. slow to heat D. slow to freeze 1. heat of fusion 2. heat of vaporization 3. capillarity 4. surface tension

57 What is the difference between stable and neutral for atoms? STABLE Outer electron shells are full NEUTRAL Number of protons equal the number of electrons

58 Which is cohesion and which is adhesion? A. sticking to like substances B. sticking to unlike substances ANSWER: A is cohesion B is adhesion

59 Which is a mixture and which is a compound? Salt water Glucose Water Air Blood Mixture Compound C 6 H 12 O 6 H 2 O compound Mixture mixture

60 Identify the monomer: POLYMERS (macromolecules) Carbohydrate Protein Lipid Nucleic Acid MONOMERS Monosaccharide Amino Acid Fatty acid + glycerol nucleotide

61 What two ions does water dissociate (break) into? H - and O + H and OH H + and OH - H 2 and O 2 ANSWER: H + and OH - (acids) (bases)

62 An atom is stable when: A. Its protons equal its neutrons B. Its electrons equal its protons C. Its outer electron shell is filled. D. Its outer electron shell is empty. ANSWER: C (e- fill 2,8,8)

63 Match the functional groups: - NH2 -COOH -C=O -OH Carbonyl Carboxyl Amino hydroxyl

64 Match the functional groups: (now in correct order) - NH 2 -COOH -C=O -OH Amino Carboxyl Carbonyl hydroxyl

65 What part of atoms form bonds? Electrons Protons Neutrons ANSWER: electrons

66 If you had an atomic number of… 12, how many electrons would be in the outer shell? ANSWER: 2 (fills 2, 8, 2)

67 Polar Covalent means: A. electrons are shared equally B. electrons are not shared equally ANSWER: electrons are not shared equally Like water (H+ end and O- end)

68 A carbon atom can form: A. Two covalent bonds B. Three covalent bonds C. Four covalent bonds D. Five covalent bonds ANSWER: C

69 What are other names for proteins? Polypeptide Amino acid chain Fatty acid Polyunsaturate Polysaccharide ANSWER: polypeptide, amino acid chain

70 What are the four bases of nucleic acids? 1. A-C-O-T 2. A-T-C-G 3. C-G-O-H 4. T-O-G-C ANSWER: A-T-C-G

71 What are the reactants and what are the products?

72 What are the reactant and what are the products?

73 Identify the substrate, the active site, and the product. A B C

74 Substrate = what the enzyme acts upon (lactase) Active site=where the enzyme + substrate (lactose) meet

75 Enzymes end in: A. -ase B. -ose C. -ise D. –ese ANSWER: -ase

76 All organic compounds contain: A. C and O and N B. C and Ca and S C. O and P D. C and H and O ANSWER: D

77 How strong are H-bonds? A. weak B. medium C. strong ANSWER: weak

78 Which are enzymes? A. proteins B. fats C. nucleic acids D. carbohydrates ANSWER: A. proteins

79 Which are enzymes? (pick 2) A. phospholipid membranes B. Energy sources C. biological catalysts (speed up reactions) D. storage molecules E. proteins ANSWER: biological catalysts proteins

80 What would an enzyme lactase work on? LACTOSE GALACTOSE SUCROSE LIPOSE ANSWER: lactose

81 Which is a saturated fat? A. B. C. CH 3 CH 2 CH 2 COOH CH3(CH2)4CH=CHCH2CH=CH(CH2)7COO H

82 Which is a saturated fat? A. B. C. CH 3 CH 2 CH 2 COOH CH3(CH2)4CH=CHCH2CH=CH(CH2)7COO H

83 Whats it called? Removing water to link monomers for form a polymer: A. dehydration synthesis B. hydrolysis C. chemiosmosis ANSWER: A Hydrolysis adds water to split polymers

84 Matching: 1. glycogen 2. cellulose 3. glucose 4. starch A. a polysaccharide in plant cells cell walls B. The storage form of glucose in plants C. The storage form of glucose in animals D. simple sugar

85 Matching: 1. glycogen C 2. cellulose A 3. glucose D 4. starch B A. a polysaccharide in plant cell walls B. The storage form of glucose in plants C. The storage form of glucose in animals D. simple sugar

86 Matching: Monomers 1. fatty acids + glycerol 2. monosaccharide 3. nucleotide 4. amino acid Polymers A. protein B. lipids C. nucleic acids D. carbohydrates

87 Matching: Monomers 1. fatty acids + glycerol B 2. monosaccharide D 3. nucleotide C 4. amino acid A Polymers A. protein B. lipids C. nucleic acids D. carbohydrates

88 Which one does not belong with the other three terms? A. protein B. polypeptide C. lipid D. amino acid chain ANSWER: C

89 Which test is this? Food sample turned blue-black in the presence of iodine? A. for protein B. for starch C. for lipids D. for simple sugars ANSWER: B

90 MACROMOLECULE TESTS A. for protein (Biurets blue to purple) B. for starch (iodine turns blue-black) C. for lipids (paper translucent to light) D. for simple sugars (Benedicts blue to orange)

91 What is the most abundant organic compound on earth? (It is also in cell walls of plants.) A. glucose B. chitin C. peptidoglycan D. cellulose ANSWER: D (cellulose is in cell walls of plants)

92 What is another name for a fat? A. triglyceride B. protein C. nucleic acid D. polysaccharide ANSWER: A (3 fatty acids + glycerol)

93 Metric to Metric Conversion Km hm dkm m dm cm mm µm nm Å So…looking on the microscope if your field of view was 4 mm, how many µm is that?

94 Metric to Metric Conversion Km hm dkm m dm cm mm µm nm Å mm = ______µm So…looking on the microscope if your field of view was 4 mm, how many µm is that? ANSWER: 4000 µm (micrometers) Multiply by 1000 (decimal 3 to right)

95 What is the ability to tell two objects apart in a microscope? A. resolving power B. magnification C.parfocal D. scanning ANSWER: A

96 Which microscope(s) can view organisms up to 1,000,000 times? A. CLM B. SEM C. TEM ANSWER: both SEM and TEM

97 What do eukaryotic cells have that prokaryotic cells do not? A. plasma membrane B. nucleus C. cell wall D. flagellum ANSWER: B


99 NOTE! Mrs. Sheldons Students do not need to go farther than this power point for Semester I Exam You do need to go to the second power point.

100 What structures can be found in plant cells but not in animal cells? A. centrioles and cilia B. chloroplasts and flagella C. capsule and cell wall D. cell wall and chloroplasts ANSWER: D

101 What structures can be found in animal cells but not in plant cells? A. centrioles and cilia B. chloroplasts and flagella C. capsule and cell wall D. cell wall and chloroplasts ANSWER: A

102 Put in order from smallest to largest: Mitochondrion ribosome nucleus vesicle ANSWER: (smallest) ribosome Vesicle Mitochondrion Nucleus (largest)

103 Microtubules and microfilaments are both part of a cells… A. nucleus B. cytoskeleton C. endomembrane D. endoplasmic reticulum ANSWER: B

104 What is the job of centrioles? A. protect the cell B. cell movement C. cell division D. DNA C. cell division

105 Which organelle repackages proteins? A. mitochondrion B. chloroplast C. Golgi apparatus D. lysosome ANSWER: C

106 Where are ribosomes assembled? A. nucleolus B. Golgi apparatus C. mitochondrion D. lysosomes ANSWER: A

107 What are loose, long fibers of DNA? A. ER B. chromosomes C. nucleolus D. chromatin ANSWER: D

108 Rough and Smooth ER Whats the difference? (structure and function) ANSWER: Rough (has ribosomes, assembles proteins) and Smooth (has no ribosomes and assembles lipids)


110 What is the general term for… Microtubules and microfilaments? A. cytoskeleton B. plasma membrane C. flagella and cilia D. lysosomes ANSWER: A



113 Name the Organelles


115 Which is the plant cell?


117 Which organelle? 1. Stores food or water 2. Modifies proteins 3. Called the clean- up crew 4. Is the site of the genetic material 5. Is the powerhouse 1. VACUOLE 2. GOLGI APPARATUS 3. LYSOSOME 4. NUCLEUS 5. MITOCHONDRION

118 Which organelle? 1. Is the site of photosynthesis? 2. Is the support framework? 3. Controls what goes in and out of the cell? 4. Carries materials from the ER to the Golgi. 1. chloroplast 2. cytoskeleton 3. plasma membrane 4. Vesicle

119 How big is one cells length? A. 1 mm B. 0.5 mm C. 2 mm D mm ANSWER: 0.5 mm

120 In which cells would you find these organelles? A. mitochondrion B. ribosomes Plant and animal All cells (plant, animal and prokaryote)

121 In what type of cells would you find cell walls? A. plant B. animal C. bacteria ANSWER: A and C

122 Which organelle is the chloroplast and which is the mitochondrion? (answer next slide)

123 Which organelle is the chloroplast and which is the mitochondrion?

124 Who first coined the word cells? Pasteur Leeuwenhoek Hooke Virchow ANSWER: Hooke

125 Who is given credit for the first microscope? Pasteur Leeuwenhoek Hooke Virchow ANSWER: Leeuwenhoek

126 Why would the cell membrane also be called the Fluid Mosaic Model?

127 Fluid Mosaic Model Parts of the membrane shift back and forth There are parts (protein channels and carbohydrate chains) embedded in it.

128 Locate: hydrophobic layer hydrophilic layer carbohydrate chain protein channel

129 ANSWERS: Hydrophilic hydrophobic Carbohydrate chain Protein channel

130 In which direction will the water flow?

131 From hypotonic to hypertonic solution

132 In equilibrium it means there is… A. No net movement of molecules across a membrane. B. No movement of molecules across a membrane. C. more movement of molecules across a membrane. ANSWER: A

133 O=osmosis D=diffusion N=neither B=both Hi to lo concentration Through a selectively permeable membrane Flow of water Flow of gases Down the gradient Against the gradient Both O O D B N

134 Identify Isotonic, hypotonic, hypertonic

135 Identify Isotonic, hypotonic, hypertonic solutions outside the cell. HYPOTONICISOTONICHYPERTONIC

136 What type of passive transport through a cell is using a protein? A. active B. phagocytosis C. diffusion D. facilitated diffusion ANSWER: D

137 Matching: CHOICES 1. engulfing small pockets of liquid 2. material leaving the cell 3. engulfing large particles 4. general term form engulfing particles into the cell Endocytosis Pinocytosis Exocytosis Phagocytosis

138 Matching: 1. engulfing small pockets of liquid 2. material leaving the cell 3. engulfing large particles 4. general term form engulfing particles into the cell Pinocytosis Exocytosis Phagocytosis Endocytosis

139 How is active transport different from passive transport? A. uses a protein B. uses energy C. uses a membrane D. is down the gradient E. Moves against the gradient ANSWER: B and E

140 Identify as U=unicellular or M=multicellular Amoeba Human Bacteria Paramecium Worm tree U M U U M M

141 What do bacteria have that protists do not? A. cell wall B. nucleus C. capsule D. chloroplasts ANSWER: C

Download ppt "SEMESTER I EXAM Review A 2011 SHELDON BIOLOGY. Match Parts of Scientific Method Problem Statement Hypothesis Experiment Conclusion If and then… Agree."

Similar presentations

Ads by Google